About 6-methylidene-2-propan-2-yl-4,5-dihydro-1H-pyrimidine
6-methylidene-2-propan-2-yl-4,5-dihydro-1H-pyrimidine (PubChem CID 22959167) has the molecular formula C8H14N2
and a molecular weight of 138.21 g/mol. Its IUPAC name is 6-methylidene-2-propan-2-yl-4,5-dihydro-1H-pyrimidine.
Analyze 6-methylidene-2-propan-2-yl-4,5-dihydro-1H-pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methylidene-2-propan-2-yl-4,5-dihydro-1H-pyrimidine?
The IUPAC name of 6-methylidene-2-propan-2-yl-4,5-dihydro-1H-pyrimidine (CID 22959167) is 6-methylidene-2-propan-2-yl-4,5-dihydro-1H-pyrimidine.
What is the SMILES notation for 6-methylidene-2-propan-2-yl-4,5-dihydro-1H-pyrimidine?
The canonical SMILES for 6-methylidene-2-propan-2-yl-4,5-dihydro-1H-pyrimidine is C=C1CCN=C(C(C)C)N1.
What is the InChIKey of 6-methylidene-2-propan-2-yl-4,5-dihydro-1H-pyrimidine?
The InChIKey is SRBOCGBDTKFGGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N2/c1-6(2)8-9-5-4-7(3)10-8/h6H,3-5H2,1-2H3,(H,9,10).
What are the key properties of 6-methylidene-2-propan-2-yl-4,5-dihydro-1H-pyrimidine?
6-methylidene-2-propan-2-yl-4,5-dihydro-1H-pyrimidine has a molecular weight of 138.21 g/mol, XLogP of 1.55, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methylidene-2-propan-2-yl-4,5-dihydro-1H-pyrimidine is sourced from PubChem (CID 22959167), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).