C18H26N4O2 — CID 164879177
3-[4-(3,5-dimethyl-1H-pyrazol-4-yl)piperazin-1-yl]benzoic acid;ethane (PubChem CID 164879177) has the molecular formula C18H26N4O2 and a molecular weight of 330.43 g/mol. Its IUPAC name is 3-[4-(3,5-dimethyl-1H-pyrazol-4-yl)piperazin-1-yl]benzoic acid;ethane.
| Compound Name | 3-[4-(3,5-dimethyl-1H-pyrazol-4-yl)piperazin-1-yl]benzoic acid;ethane |
|---|---|
| PubChem CID | 164879177 |
| Molecular Formula | C18H26N4O2 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.21 |
| IUPAC Name | 3-[4-(3,5-dimethyl-1H-pyrazol-4-yl)piperazin-1-yl]benzoic acid;ethane |
| SMILES | CC.Cc1n[nH]c(C)c1N1CCN(c2cccc(C(=O)O)c2)CC1 |
| InChI | InChI=1S/C16H20N4O2.C2H6/c1-11-15(12(2)18-17-11)20-8-6-19(7-9-20)14-5-3-4-13(10-14)16(21)22;1-2/h3-5,10H,6-9H2,1-2H3,(H,17,18)(H,21,22);1-2H3 |
| InChIKey | IODDJPSJPJSDFI-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 72.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |