C17H22N4O2 — CID 171466139
methyl 3-[4-(3,5-dimethyl-1H-pyrazol-4-yl)piperazin-1-yl]benzoate (PubChem CID 171466139) has the molecular formula C17H22N4O2 and a molecular weight of 314.39 g/mol. Its IUPAC name is methyl 3-[4-(3,5-dimethyl-1H-pyrazol-4-yl)piperazin-1-yl]benzoate.
| Compound Name | methyl 3-[4-(3,5-dimethyl-1H-pyrazol-4-yl)piperazin-1-yl]benzoate |
|---|---|
| PubChem CID | 171466139 |
| Molecular Formula | C17H22N4O2 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | methyl 3-[4-(3,5-dimethyl-1H-pyrazol-4-yl)piperazin-1-yl]benzoate |
| SMILES | COC(=O)c1cccc(N2CCN(c3c(C)n[nH]c3C)CC2)c1 |
| InChI | InChI=1S/C17H22N4O2/c1-12-16(13(2)19-18-12)21-9-7-20(8-10-21)15-6-4-5-14(11-15)17(22)23-3/h4-6,11H,7-10H2,1-3H3,(H,18,19) |
| InChIKey | VRCFAKSIZBPIIQ-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 61.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |