C28H31N3O2 — CID 164880624
3-(1-benzhydrylpiperidin-4-yl)-7-nitro-1,2,4,5-tetrahydro-3-benzazepine (PubChem CID 164880624) has the molecular formula C28H31N3O2 and a molecular weight of 441.58 g/mol. Its IUPAC name is 3-(1-benzhydrylpiperidin-4-yl)-7-nitro-1,2,4,5-tetrahydro-3-benzazepine.
| Compound Name | 3-(1-benzhydrylpiperidin-4-yl)-7-nitro-1,2,4,5-tetrahydro-3-benzazepine |
|---|---|
| PubChem CID | 164880624 |
| Molecular Formula | C28H31N3O2 |
| Molecular Weight | 441.58 g/mol |
| Exact Mass | 441.24 |
| IUPAC Name | 3-(1-benzhydrylpiperidin-4-yl)-7-nitro-1,2,4,5-tetrahydro-3-benzazepine |
| SMILES | O=[N+]([O-])c1ccc2c(c1)CCN(C1CCN(C(c3ccccc3)c3ccccc3)CC1)CC2 |
| InChI | InChI=1S/C28H31N3O2/c32-31(33)27-12-11-22-13-17-29(18-14-25(22)21-27)26-15-19-30(20-16-26)28(23-7-3-1-4-8-23)24-9-5-2-6-10-24/h1-12,21,26,28H,13-20H2 |
| InChIKey | PHZOPVXZHFMHCM-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 49.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.58 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|