C11H16N2 — CID 164882940
3,6-dimethylpyrazolo[1,5-a]pyridine;ethane (PubChem CID 164882940) has the molecular formula C11H16N2 and a molecular weight of 176.26 g/mol. Its IUPAC name is 3,6-dimethylpyrazolo[1,5-a]pyridine;ethane.
| Compound Name | 3,6-dimethylpyrazolo[1,5-a]pyridine;ethane |
|---|---|
| PubChem CID | 164882940 |
| Molecular Formula | C11H16N2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.13 |
| IUPAC Name | 3,6-dimethylpyrazolo[1,5-a]pyridine;ethane |
| SMILES | CC.Cc1ccc2c(C)cnn2c1 |
| InChI | InChI=1S/C9H10N2.C2H6/c1-7-3-4-9-8(2)5-10-11(9)6-7;1-2/h3-6H,1-2H3;1-2H3 |
| InChIKey | UEXHVPRYWTYTRF-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |