C11H14N2O — CID 170379692
6-(2-methoxyethyl)-3-methylpyrazolo[1,5-a]pyridine (PubChem CID 170379692) has the molecular formula C11H14N2O and a molecular weight of 190.25 g/mol. Its IUPAC name is 6-(2-methoxyethyl)-3-methylpyrazolo[1,5-a]pyridine.
| Compound Name | 6-(2-methoxyethyl)-3-methylpyrazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 170379692 |
| Molecular Formula | C11H14N2O |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.11 |
| IUPAC Name | 6-(2-methoxyethyl)-3-methylpyrazolo[1,5-a]pyridine |
| SMILES | COCCc1ccc2c(C)cnn2c1 |
| InChI | InChI=1S/C11H14N2O/c1-9-7-12-13-8-10(5-6-14-2)3-4-11(9)13/h3-4,7-8H,5-6H2,1-2H3 |
| InChIKey | OHSOVEDPSBVDKB-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 26.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |