About 3-bromoprop-2-enyl ethyl carbonate
3-bromoprop-2-enyl ethyl carbonate (PubChem CID 164884276) has the molecular formula C6H9BrO3
and a molecular weight of 209.04 g/mol. Its IUPAC name is 3-bromoprop-2-enyl ethyl carbonate.
Molecular Properties
| Compound Name | 3-bromoprop-2-enyl ethyl carbonate |
| PubChem CID | 164884276 |
| Molecular Formula | C6H9BrO3 |
| Molecular Weight | 209.04 g/mol |
| Exact Mass | 207.97 |
| IUPAC Name | 3-bromoprop-2-enyl ethyl carbonate |
| SMILES | CCOC(=O)OCC=CBr |
| InChI | InChI=1S/C6H9BrO3/c1-2-9-6(8)10-5-3-4-7/h3-4H,2,5H2,1H3 |
| InChIKey | NIRVQNVMKVVXEF-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.04 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-bromoprop-2-enyl ethyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromoprop-2-enyl ethyl carbonate?
The IUPAC name of 3-bromoprop-2-enyl ethyl carbonate (CID 164884276) is 3-bromoprop-2-enyl ethyl carbonate.
What is the SMILES notation for 3-bromoprop-2-enyl ethyl carbonate?
The canonical SMILES for 3-bromoprop-2-enyl ethyl carbonate is CCOC(=O)OCC=CBr.
What is the InChIKey of 3-bromoprop-2-enyl ethyl carbonate?
The InChIKey is NIRVQNVMKVVXEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9BrO3/c1-2-9-6(8)10-5-3-4-7/h3-4H,2,5H2,1H3.
What are the key properties of 3-bromoprop-2-enyl ethyl carbonate?
3-bromoprop-2-enyl ethyl carbonate has a molecular weight of 209.04 g/mol, XLogP of 2.07, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromoprop-2-enyl ethyl carbonate is sourced from PubChem (CID 164884276), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).