C24H20N4O4 — CID 164884299
4-[[2-(4-methoxyphenyl)ethyl-(6-nitro-1,3-benzoxazol-2-yl)amino]methyl]benzonitrile (PubChem CID 164884299) has the molecular formula C24H20N4O4 and a molecular weight of 428.45 g/mol. Its IUPAC name is 4-[[2-(4-methoxyphenyl)ethyl-(6-nitro-1,3-benzoxazol-2-yl)amino]methyl]benzonitrile.
| Compound Name | 4-[[2-(4-methoxyphenyl)ethyl-(6-nitro-1,3-benzoxazol-2-yl)amino]methyl]benzonitrile |
|---|---|
| PubChem CID | 164884299 |
| Molecular Formula | C24H20N4O4 |
| Molecular Weight | 428.45 g/mol |
| Exact Mass | 428.15 |
| IUPAC Name | 4-[[2-(4-methoxyphenyl)ethyl-(6-nitro-1,3-benzoxazol-2-yl)amino]methyl]benzonitrile |
| SMILES | COc1ccc(CCN(Cc2ccc(C#N)cc2)c2nc3ccc([N+](=O)[O-])cc3o2)cc1 |
| InChI | InChI=1S/C24H20N4O4/c1-31-21-9-6-17(7-10-21)12-13-27(16-19-4-2-18(15-25)3-5-19)24-26-22-11-8-20(28(29)30)14-23(22)32-24/h2-11,14H,12-13,16H2,1H3 |
| InChIKey | VJLTVHTXVDLCET-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 105.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.45 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|