C20H17N5O — CID 164884825
6-(4-amino-3-cyanophenyl)-N-[(2-methyl-3-pyridinyl)methyl]pyridine-3-carboxamide (PubChem CID 164884825) has the molecular formula C20H17N5O and a molecular weight of 343.39 g/mol. Its IUPAC name is 6-(4-amino-3-cyanophenyl)-N-[(2-methyl-3-pyridinyl)methyl]pyridine-3-carboxamide.
| Compound Name | 6-(4-amino-3-cyanophenyl)-N-[(2-methyl-3-pyridinyl)methyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 164884825 |
| Molecular Formula | C20H17N5O |
| Molecular Weight | 343.39 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | 6-(4-amino-3-cyanophenyl)-N-[(2-methyl-3-pyridinyl)methyl]pyridine-3-carboxamide |
| SMILES | Cc1ncccc1CNC(=O)c1ccc(-c2ccc(N)c(C#N)c2)nc1 |
| InChI | InChI=1S/C20H17N5O/c1-13-15(3-2-8-23-13)11-25-20(26)16-5-7-19(24-12-16)14-4-6-18(22)17(9-14)10-21/h2-9,12H,11,22H2,1H3,(H,25,26) |
| InChIKey | GQBIQLKNVBIBMZ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 104.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.39 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|