C13H25N3O2 — CID 164886000
1-butoxy-3-(3-imidazol-1-ylpropylamino)propan-2-ol (PubChem CID 164886000) has the molecular formula C13H25N3O2 and a molecular weight of 255.36 g/mol. Its IUPAC name is 1-butoxy-3-(3-imidazol-1-ylpropylamino)propan-2-ol.
| Compound Name | 1-butoxy-3-(3-imidazol-1-ylpropylamino)propan-2-ol |
|---|---|
| PubChem CID | 164886000 |
| Molecular Formula | C13H25N3O2 |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.19 |
| IUPAC Name | 1-butoxy-3-(3-imidazol-1-ylpropylamino)propan-2-ol |
| SMILES | CCCCOCC(O)CNCCCn1ccnc1 |
| InChI | InChI=1S/C13H25N3O2/c1-2-3-9-18-11-13(17)10-14-5-4-7-16-8-6-15-12-16/h6,8,12-14,17H,2-5,7,9-11H2,1H3 |
| InChIKey | IVNNIFKFDPHCBK-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|