C16H13F6NO2 — CID 164887491
N-(5-methyl-3-oxocyclohexen-1-yl)-3,5-bis(trifluoromethyl)benzamide (PubChem CID 164887491) has the molecular formula C16H13F6NO2 and a molecular weight of 365.27 g/mol. Its IUPAC name is N-(5-methyl-3-oxocyclohexen-1-yl)-3,5-bis(trifluoromethyl)benzamide.
| Compound Name | N-(5-methyl-3-oxocyclohexen-1-yl)-3,5-bis(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 164887491 |
| Molecular Formula | C16H13F6NO2 |
| Molecular Weight | 365.27 g/mol |
| Exact Mass | 365.09 |
| IUPAC Name | N-(5-methyl-3-oxocyclohexen-1-yl)-3,5-bis(trifluoromethyl)benzamide |
| SMILES | CC1CC(=O)C=C(NC(=O)c2cc(C(F)(F)F)cc(C(F)(F)F)c2)C1 |
| InChI | InChI=1S/C16H13F6NO2/c1-8-2-12(7-13(24)3-8)23-14(25)9-4-10(15(17,18)19)6-11(5-9)16(20,21)22/h4-8H,2-3H2,1H3,(H,23,25) |
| InChIKey | FQYYLUWOYDBKPV-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.27 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |