C15H14F3NO2 — CID 164887490
N-(5-methyl-3-oxocyclohexen-1-yl)-3-(trifluoromethyl)benzamide (PubChem CID 164887490) has the molecular formula C15H14F3NO2 and a molecular weight of 297.28 g/mol. Its IUPAC name is N-(5-methyl-3-oxocyclohexen-1-yl)-3-(trifluoromethyl)benzamide.
| Compound Name | N-(5-methyl-3-oxocyclohexen-1-yl)-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 164887490 |
| Molecular Formula | C15H14F3NO2 |
| Molecular Weight | 297.28 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | N-(5-methyl-3-oxocyclohexen-1-yl)-3-(trifluoromethyl)benzamide |
| SMILES | CC1CC(=O)C=C(NC(=O)c2cccc(C(F)(F)F)c2)C1 |
| InChI | InChI=1S/C15H14F3NO2/c1-9-5-12(8-13(20)6-9)19-14(21)10-3-2-4-11(7-10)15(16,17)18/h2-4,7-9H,5-6H2,1H3,(H,19,21) |
| InChIKey | VRHFJCNAIWFYLN-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.28 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |