C17H18FNO2 — CID 660151
N-[(1E)-1-[(1S,5R)-6,6-dimethyl-3-oxo-2-bicyclo[3.1.0]hexanylidene]ethyl]-2-fluorobenzamide (PubChem CID 660151) has the molecular formula C17H18FNO2 and a molecular weight of 287.33 g/mol. Its IUPAC name is N-[(1E)-1-[(1S,5R)-6,6-dimethyl-3-oxo-2-bicyclo[3.1.0]hexanylidene]ethyl]-2-fluorobenzamide.
| Compound Name | N-[(1E)-1-[(1S,5R)-6,6-dimethyl-3-oxo-2-bicyclo[3.1.0]hexanylidene]ethyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 660151 |
| Molecular Formula | C17H18FNO2 |
| Molecular Weight | 287.33 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | N-[(1E)-1-[(1S,5R)-6,6-dimethyl-3-oxo-2-bicyclo[3.1.0]hexanylidene]ethyl]-2-fluorobenzamide |
| SMILES | C/C(NC(=O)c1ccccc1F)=C1\C(=O)C[C@@H]2[C@H]1C2(C)C |
| InChI | InChI=1S/C17H18FNO2/c1-9(14-13(20)8-11-15(14)17(11,2)3)19-16(21)10-6-4-5-7-12(10)18/h4-7,11,15H,8H2,1-3H3,(H,19,21)/b14-9-/t11-,15-/m1/s1 |
| InChIKey | WYWUNAYYDOLKLE-BPLLEURISA-N |
| XLogP | 3.07 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.33 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|