C22H21IN2O2 — CID 164887795
(5,5-dicyano-3,3-dimethyl-4-phenylpentyl) 4-iodobenzoate (PubChem CID 164887795) has the molecular formula C22H21IN2O2 and a molecular weight of 472.33 g/mol. Its IUPAC name is (5,5-dicyano-3,3-dimethyl-4-phenylpentyl) 4-iodobenzoate.
| Compound Name | (5,5-dicyano-3,3-dimethyl-4-phenylpentyl) 4-iodobenzoate |
|---|---|
| PubChem CID | 164887795 |
| Molecular Formula | C22H21IN2O2 |
| Molecular Weight | 472.33 g/mol |
| Exact Mass | 472.06 |
| IUPAC Name | (5,5-dicyano-3,3-dimethyl-4-phenylpentyl) 4-iodobenzoate |
| SMILES | CC(C)(CCOC(=O)c1ccc(I)cc1)C(c1ccccc1)C(C#N)C#N |
| InChI | InChI=1S/C22H21IN2O2/c1-22(2,12-13-27-21(26)17-8-10-19(23)11-9-17)20(18(14-24)15-25)16-6-4-3-5-7-16/h3-11,18,20H,12-13H2,1-2H3 |
| InChIKey | ASKSSRTZNWNVBJ-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 73.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.33 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|