C32H29F6N5O — CID 164887993
(3R)-3-[benzyl-[(E)-3-phenylprop-2-enyl]amino]-1-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-4-(2,4,5-trifluorophenyl)butan-1-one (PubChem CID 164887993) has the molecular formula C32H29F6N5O and a molecular weight of 613.61 g/mol. Its IUPAC name is (3R)-3-[benzyl-[(E)-3-phenylprop-2-enyl]amino]-1-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-4-(2,4,5-trifluorophenyl)butan-1-one.
| Compound Name | (3R)-3-[benzyl-[(E)-3-phenylprop-2-enyl]amino]-1-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-4-(2,4,5-trifluorophenyl)butan-1-one |
|---|---|
| PubChem CID | 164887993 |
| Molecular Formula | C32H29F6N5O |
| Molecular Weight | 613.61 g/mol |
| Exact Mass | 613.23 |
| IUPAC Name | (3R)-3-[benzyl-[(E)-3-phenylprop-2-enyl]amino]-1-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-4-(2,4,5-trifluorophenyl)butan-1-one |
| SMILES | O=C(C[C@@H](Cc1cc(F)c(F)cc1F)N(C/C=C/c1ccccc1)Cc1ccccc1)N1CCn2c(nnc2C(F)(F)F)C1 |
| InChI | InChI=1S/C32H29F6N5O/c33-26-19-28(35)27(34)17-24(26)16-25(18-30(44)42-14-15-43-29(21-42)39-40-31(43)32(36,37)38)41(20-23-10-5-2-6-11-23)13-7-12-22-8-3-1-4-9-22/h1-12,17,19,25H,13-16,18,20-21H2/b12-7+/t25-/m1/s1 |
| InChIKey | FQYNOIYQVXLKSI-VISBSAOHSA-N |
| XLogP | 6.27 |
| TPSA | 54.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.61 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|