C25H25NO2 — CID 164888036
methyl 3-(benzhydrylideneamino)-3-(2,5-dimethylphenyl)propanoate (PubChem CID 164888036) has the molecular formula C25H25NO2 and a molecular weight of 371.48 g/mol. Its IUPAC name is methyl 3-(benzhydrylideneamino)-3-(2,5-dimethylphenyl)propanoate.
| Compound Name | methyl 3-(benzhydrylideneamino)-3-(2,5-dimethylphenyl)propanoate |
|---|---|
| PubChem CID | 164888036 |
| Molecular Formula | C25H25NO2 |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.19 |
| IUPAC Name | methyl 3-(benzhydrylideneamino)-3-(2,5-dimethylphenyl)propanoate |
| SMILES | COC(=O)CC(N=C(c1ccccc1)c1ccccc1)c1cc(C)ccc1C |
| InChI | InChI=1S/C25H25NO2/c1-18-14-15-19(2)22(16-18)23(17-24(27)28-3)26-25(20-10-6-4-7-11-20)21-12-8-5-9-13-21/h4-16,23H,17H2,1-3H3 |
| InChIKey | UDOQQSHWAYWBGD-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|