C25H23N3O3S — CID 164888476
4-[3-(3,4-dimethoxyphenyl)-2-(4-methyl-1,3-benzothiazol-2-yl)-3,4-dihydropyrazol-5-yl]phenol (PubChem CID 164888476) has the molecular formula C25H23N3O3S and a molecular weight of 445.54 g/mol. Its IUPAC name is 4-[3-(3,4-dimethoxyphenyl)-2-(4-methyl-1,3-benzothiazol-2-yl)-3,4-dihydropyrazol-5-yl]phenol.
| Compound Name | 4-[3-(3,4-dimethoxyphenyl)-2-(4-methyl-1,3-benzothiazol-2-yl)-3,4-dihydropyrazol-5-yl]phenol |
|---|---|
| PubChem CID | 164888476 |
| Molecular Formula | C25H23N3O3S |
| Molecular Weight | 445.54 g/mol |
| Exact Mass | 445.15 |
| IUPAC Name | 4-[3-(3,4-dimethoxyphenyl)-2-(4-methyl-1,3-benzothiazol-2-yl)-3,4-dihydropyrazol-5-yl]phenol |
| SMILES | COc1ccc(C2CC(c3ccc(O)cc3)=NN2c2nc3c(C)cccc3s2)cc1OC |
| InChI | InChI=1S/C25H23N3O3S/c1-15-5-4-6-23-24(15)26-25(32-23)28-20(17-9-12-21(30-2)22(13-17)31-3)14-19(27-28)16-7-10-18(29)11-8-16/h4-13,20,29H,14H2,1-3H3 |
| InChIKey | FNKBJRIRCQMEKV-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 67.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.54 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'} |
|---|