C13H18O3 — CID 164889754
(4R,5R,6S)-4,5,6-trimethyl-3-oxo-2,5,6,7-tetrahydro-1H-indene-4-carboxylic acid (PubChem CID 164889754) has the molecular formula C13H18O3 and a molecular weight of 222.28 g/mol. Its IUPAC name is (4R,5R,6S)-4,5,6-trimethyl-3-oxo-2,5,6,7-tetrahydro-1H-indene-4-carboxylic acid.
| Compound Name | (4R,5R,6S)-4,5,6-trimethyl-3-oxo-2,5,6,7-tetrahydro-1H-indene-4-carboxylic acid |
|---|---|
| PubChem CID | 164889754 |
| Molecular Formula | C13H18O3 |
| Molecular Weight | 222.28 g/mol |
| Exact Mass | 222.13 |
| IUPAC Name | (4R,5R,6S)-4,5,6-trimethyl-3-oxo-2,5,6,7-tetrahydro-1H-indene-4-carboxylic acid |
| SMILES | C[C@@H]1[C@@H](C)CC2=C(C(=O)CC2)[C@]1(C)C(=O)O |
| InChI | InChI=1S/C13H18O3/c1-7-6-9-4-5-10(14)11(9)13(3,8(7)2)12(15)16/h7-8H,4-6H2,1-3H3,(H,15,16)/t7-,8+,13+/m0/s1 |
| InChIKey | YYHIDFRRNILRGJ-HHURGBBESA-N |
| XLogP | 2.41 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.28 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |