C10H12F2OS — CID 164895301
1-(5-butylthiophen-2-yl)-2,2-difluoroethanone (PubChem CID 164895301) has the molecular formula C10H12F2OS and a molecular weight of 218.27 g/mol. Its IUPAC name is 1-(5-butylthiophen-2-yl)-2,2-difluoroethanone.
| Compound Name | 1-(5-butylthiophen-2-yl)-2,2-difluoroethanone |
|---|---|
| PubChem CID | 164895301 |
| Molecular Formula | C10H12F2OS |
| Molecular Weight | 218.27 g/mol |
| Exact Mass | 218.06 |
| IUPAC Name | 1-(5-butylthiophen-2-yl)-2,2-difluoroethanone |
| SMILES | CCCCc1ccc(C(=O)C(F)F)s1 |
| InChI | InChI=1S/C10H12F2OS/c1-2-3-4-7-5-6-8(14-7)9(13)10(11)12/h5-6,10H,2-4H2,1H3 |
| InChIKey | CKWAXZNMQUOLJB-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.27 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |