C19H20N2O3 — CID 164897112
1-butyl-3-oxo-N'-phenyl-1H-2-benzofuran-5-carbohydrazide (PubChem CID 164897112) has the molecular formula C19H20N2O3 and a molecular weight of 324.38 g/mol. Its IUPAC name is 1-butyl-3-oxo-N'-phenyl-1H-2-benzofuran-5-carbohydrazide.
| Compound Name | 1-butyl-3-oxo-N'-phenyl-1H-2-benzofuran-5-carbohydrazide |
|---|---|
| PubChem CID | 164897112 |
| Molecular Formula | C19H20N2O3 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | 1-butyl-3-oxo-N'-phenyl-1H-2-benzofuran-5-carbohydrazide |
| SMILES | CCCCC1OC(=O)c2cc(C(=O)NNc3ccccc3)ccc21 |
| InChI | InChI=1S/C19H20N2O3/c1-2-3-9-17-15-11-10-13(12-16(15)19(23)24-17)18(22)21-20-14-7-5-4-6-8-14/h4-8,10-12,17,20H,2-3,9H2,1H3,(H,21,22) |
| InChIKey | GHUYVICNEAKGOR-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|