About 7-thia-8,9,10-triazatricyclo[4.4.0.02,8]deca-1,3,5,9-tetraene
7-thia-8,9,10-triazatricyclo[4.4.0.02,8]deca-1,3,5,9-tetraene (PubChem CID 164898863) has the molecular formula C6H3N3S
and a molecular weight of 149.18 g/mol. Its IUPAC name is 7-thia-8,9,10-triazatricyclo[4.4.0.02,8]deca-1,3,5,9-tetraene.
Analyze 7-thia-8,9,10-triazatricyclo[4.4.0.02,8]deca-1,3,5,9-tetraene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-thia-8,9,10-triazatricyclo[4.4.0.02,8]deca-1,3,5,9-tetraene?
The IUPAC name of 7-thia-8,9,10-triazatricyclo[4.4.0.02,8]deca-1,3,5,9-tetraene (CID 164898863) is 7-thia-8,9,10-triazatricyclo[4.4.0.02,8]deca-1,3,5,9-tetraene.
What is the SMILES notation for 7-thia-8,9,10-triazatricyclo[4.4.0.02,8]deca-1,3,5,9-tetraene?
The canonical SMILES for 7-thia-8,9,10-triazatricyclo[4.4.0.02,8]deca-1,3,5,9-tetraene is c1cc2c3nnn(c3c1)S2.
What is the InChIKey of 7-thia-8,9,10-triazatricyclo[4.4.0.02,8]deca-1,3,5,9-tetraene?
The InChIKey is IYDIMIBNTLYOKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H3N3S/c1-2-4-6-5(3-1)10-9(4)8-7-6/h1-3H.
What are the key properties of 7-thia-8,9,10-triazatricyclo[4.4.0.02,8]deca-1,3,5,9-tetraene?
7-thia-8,9,10-triazatricyclo[4.4.0.02,8]deca-1,3,5,9-tetraene has a molecular weight of 149.18 g/mol, XLogP of 1.30, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-thia-8,9,10-triazatricyclo[4.4.0.02,8]deca-1,3,5,9-tetraene is sourced from PubChem (CID 164898863), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).