About 2-(2-fluoroacetyl)oxybutan-2-yl 2-fluoroacetate
2-(2-fluoroacetyl)oxybutan-2-yl 2-fluoroacetate (PubChem CID 164901002) has the molecular formula C8H12F2O4
and a molecular weight of 210.18 g/mol. Its IUPAC name is 2-(2-fluoroacetyl)oxybutan-2-yl 2-fluoroacetate.
Molecular Properties
| Compound Name | 2-(2-fluoroacetyl)oxybutan-2-yl 2-fluoroacetate |
| PubChem CID | 164901002 |
| Molecular Formula | C8H12F2O4 |
| Molecular Weight | 210.18 g/mol |
| Exact Mass | 210.07 |
| IUPAC Name | 2-(2-fluoroacetyl)oxybutan-2-yl 2-fluoroacetate |
| SMILES | CCC(C)(OC(=O)CF)OC(=O)CF |
| InChI | InChI=1S/C8H12F2O4/c1-3-8(2,13-6(11)4-9)14-7(12)5-10/h3-5H2,1-2H3 |
| InChIKey | BHHUXFJTMSHOOS-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.18 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-fluoroacetyl)oxybutan-2-yl 2-fluoroacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-fluoroacetyl)oxybutan-2-yl 2-fluoroacetate?
The IUPAC name of 2-(2-fluoroacetyl)oxybutan-2-yl 2-fluoroacetate (CID 164901002) is 2-(2-fluoroacetyl)oxybutan-2-yl 2-fluoroacetate.
What is the SMILES notation for 2-(2-fluoroacetyl)oxybutan-2-yl 2-fluoroacetate?
The canonical SMILES for 2-(2-fluoroacetyl)oxybutan-2-yl 2-fluoroacetate is CCC(C)(OC(=O)CF)OC(=O)CF.
What is the InChIKey of 2-(2-fluoroacetyl)oxybutan-2-yl 2-fluoroacetate?
The InChIKey is BHHUXFJTMSHOOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12F2O4/c1-3-8(2,13-6(11)4-9)14-7(12)5-10/h3-5H2,1-2H3.
What are the key properties of 2-(2-fluoroacetyl)oxybutan-2-yl 2-fluoroacetate?
2-(2-fluoroacetyl)oxybutan-2-yl 2-fluoroacetate has a molecular weight of 210.18 g/mol, XLogP of 1.14, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-fluoroacetyl)oxybutan-2-yl 2-fluoroacetate is sourced from PubChem (CID 164901002), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).