C8H13F3O4 — CID 175803499
2,2-difluorobutanoic acid;ethyl 2-fluoroacetate (PubChem CID 175803499) has the molecular formula C8H13F3O4 and a molecular weight of 230.18 g/mol. Its IUPAC name is 2,2-difluorobutanoic acid;ethyl 2-fluoroacetate.
| Compound Name | 2,2-difluorobutanoic acid;ethyl 2-fluoroacetate |
|---|---|
| PubChem CID | 175803499 |
| Molecular Formula | C8H13F3O4 |
| Molecular Weight | 230.18 g/mol |
| Exact Mass | 230.08 |
| IUPAC Name | 2,2-difluorobutanoic acid;ethyl 2-fluoroacetate |
| SMILES | CCC(F)(F)C(=O)O.CCOC(=O)CF |
| InChI | InChI=1S/C4H6F2O2.C4H7FO2/c1-2-4(5,6)3(7)8;1-2-7-4(6)3-5/h2H2,1H3,(H,7,8);2-3H2,1H3 |
| InChIKey | MMUHPIFFBINENF-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.18 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |