C33H39N5O3 — CID 164902069
1-N-[(2,4-dimethoxyphenyl)methyl]-5-N-[[4-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-7-yloxymethyl)-2-bicyclo[2.1.1]hexanyl]methyl]isoquinoline-1,5-diamine (PubChem CID 164902069) has the molecular formula C33H39N5O3 and a molecular weight of 553.71 g/mol. Its IUPAC name is 1-N-[(2,4-dimethoxyphenyl)methyl]-5-N-[[4-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-7-yloxymethyl)-2-bicyclo[2.1.1]hexanyl]methyl]isoquinoline-1,5-diamine.
| Compound Name | 1-N-[(2,4-dimethoxyphenyl)methyl]-5-N-[[4-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-7-yloxymethyl)-2-bicyclo[2.1.1]hexanyl]methyl]isoquinoline-1,5-diamine |
|---|---|
| PubChem CID | 164902069 |
| Molecular Formula | C33H39N5O3 |
| Molecular Weight | 553.71 g/mol |
| Exact Mass | 553.31 |
| IUPAC Name | 1-N-[(2,4-dimethoxyphenyl)methyl]-5-N-[[4-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-7-yloxymethyl)-2-bicyclo[2.1.1]hexanyl]methyl]isoquinoline-1,5-diamine |
| SMILES | COc1ccc(CNc2nccc3c(NCC4CC5(COC6CCn7ccnc7C6)CC4C5)cccc23)c(OC)c1 |
| InChI | InChI=1S/C33H39N5O3/c1-39-25-7-6-22(30(14-25)40-2)19-37-32-28-4-3-5-29(27(28)8-10-35-32)36-20-24-18-33(16-23(24)17-33)21-41-26-9-12-38-13-11-34-31(38)15-26/h3-8,10-11,13-14,23-24,26,36H,9,12,15-21H2,1-2H3,(H,35,37) |
| InChIKey | WHZXEJFCRRCUHI-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 82.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.71 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |