C24H20FN5 — CID 164902941
N-(7-fluoro-2,5-dimethyl-4H-[1,2,4]triazolo[1,5-a]quinoxalin-6-yl)-1,1-diphenylmethanimine (PubChem CID 164902941) has the molecular formula C24H20FN5 and a molecular weight of 397.46 g/mol. Its IUPAC name is N-(7-fluoro-2,5-dimethyl-4H-[1,2,4]triazolo[1,5-a]quinoxalin-6-yl)-1,1-diphenylmethanimine.
| Compound Name | N-(7-fluoro-2,5-dimethyl-4H-[1,2,4]triazolo[1,5-a]quinoxalin-6-yl)-1,1-diphenylmethanimine |
|---|---|
| PubChem CID | 164902941 |
| Molecular Formula | C24H20FN5 |
| Molecular Weight | 397.46 g/mol |
| Exact Mass | 397.17 |
| IUPAC Name | N-(7-fluoro-2,5-dimethyl-4H-[1,2,4]triazolo[1,5-a]quinoxalin-6-yl)-1,1-diphenylmethanimine |
| SMILES | Cc1nc2n(n1)-c1ccc(F)c(N=C(c3ccccc3)c3ccccc3)c1N(C)C2 |
| InChI | InChI=1S/C24H20FN5/c1-16-26-21-15-29(2)24-20(30(21)28-16)14-13-19(25)23(24)27-22(17-9-5-3-6-10-17)18-11-7-4-8-12-18/h3-14H,15H2,1-2H3 |
| InChIKey | PTJQJYYBDULOGG-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 46.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.46 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|