C8H23N3 — CID 164903776
ethane;2-N,3-N,3-N-trimethylpropane-1,2,3-triamine (PubChem CID 164903776) has the molecular formula C8H23N3 and a molecular weight of 161.29 g/mol. Its IUPAC name is ethane;2-N,3-N,3-N-trimethylpropane-1,2,3-triamine.
| Compound Name | ethane;2-N,3-N,3-N-trimethylpropane-1,2,3-triamine |
|---|---|
| PubChem CID | 164903776 |
| Molecular Formula | C8H23N3 |
| Molecular Weight | 161.29 g/mol |
| Exact Mass | 161.19 |
| IUPAC Name | ethane;2-N,3-N,3-N-trimethylpropane-1,2,3-triamine |
| SMILES | CC.CNC(CN)CN(C)C |
| InChI | InChI=1S/C6H17N3.C2H6/c1-8-6(4-7)5-9(2)3;1-2/h6,8H,4-5,7H2,1-3H3;1-2H3 |
| InChIKey | ALVUZTXZCUBWRO-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.29 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |