About N-[5-(2,2-difluoroethyl)-4-methoxypyrimidin-2-yl]-6-propyl-1H-indole-3-sulfinamide
N-[5-(2,2-difluoroethyl)-4-methoxypyrimidin-2-yl]-6-propyl-1H-indole-3-sulfinamide (PubChem CID 164908277) has the molecular formula C18H20F2N4O2S
and a molecular weight of 394.45 g/mol. Its IUPAC name is N-[5-(2,2-difluoroethyl)-4-methoxypyrimidin-2-yl]-6-propyl-1H-indole-3-sulfinamide.
Molecular Properties
| Compound Name | N-[5-(2,2-difluoroethyl)-4-methoxypyrimidin-2-yl]-6-propyl-1H-indole-3-sulfinamide |
| PubChem CID | 164908277 |
| Molecular Formula | C18H20F2N4O2S |
| Molecular Weight | 394.45 g/mol |
| Exact Mass | 394.13 |
| IUPAC Name | N-[5-(2,2-difluoroethyl)-4-methoxypyrimidin-2-yl]-6-propyl-1H-indole-3-sulfinamide |
| SMILES | CCCc1ccc2c(S(=O)Nc3ncc(CC(F)F)c(OC)n3)c[nH]c2c1 |
| InChI | InChI=1S/C18H20F2N4O2S/c1-3-4-11-5-6-13-14(7-11)21-10-15(13)27(25)24-18-22-9-12(8-16(19)20)17(23-18)26-2/h5-7,9-10,16,21H,3-4,8H2,1-2H3,(H,22,23,24) |
| InChIKey | SBUGVSBRELNKAB-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 394.45 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[5-(2,2-difluoroethyl)-4-methoxypyrimidin-2-yl]-6-propyl-1H-indole-3-sulfinamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[5-(2,2-difluoroethyl)-4-methoxypyrimidin-2-yl]-6-propyl-1H-indole-3-sulfinamide?
The IUPAC name of N-[5-(2,2-difluoroethyl)-4-methoxypyrimidin-2-yl]-6-propyl-1H-indole-3-sulfinamide (CID 164908277) is N-[5-(2,2-difluoroethyl)-4-methoxypyrimidin-2-yl]-6-propyl-1H-indole-3-sulfinamide.
What is the SMILES notation for N-[5-(2,2-difluoroethyl)-4-methoxypyrimidin-2-yl]-6-propyl-1H-indole-3-sulfinamide?
The canonical SMILES for N-[5-(2,2-difluoroethyl)-4-methoxypyrimidin-2-yl]-6-propyl-1H-indole-3-sulfinamide is CCCc1ccc2c(S(=O)Nc3ncc(CC(F)F)c(OC)n3)c[nH]c2c1.
What is the InChIKey of N-[5-(2,2-difluoroethyl)-4-methoxypyrimidin-2-yl]-6-propyl-1H-indole-3-sulfinamide?
The InChIKey is SBUGVSBRELNKAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20F2N4O2S/c1-3-4-11-5-6-13-14(7-11)21-10-15(13)27(25)24-18-22-9-12(8-16(19)20)17(23-18)26-2/h5-7,9-10,16,21H,3-4,8H2,1-2H3,(H,22,23,24).
What are the key properties of N-[5-(2,2-difluoroethyl)-4-methoxypyrimidin-2-yl]-6-propyl-1H-indole-3-sulfinamide?
N-[5-(2,2-difluoroethyl)-4-methoxypyrimidin-2-yl]-6-propyl-1H-indole-3-sulfinamide has a molecular weight of 394.45 g/mol, XLogP of 3.86, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[5-(2,2-difluoroethyl)-4-methoxypyrimidin-2-yl]-6-propyl-1H-indole-3-sulfinamide is sourced from PubChem (CID 164908277), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).