C14H14Cl2N4O2S — CID 176711076
[4-[(6-chloro-1H-indol-3-yl)sulfinylamino]-1-propylpyrazol-5-yl] hypochlorite (PubChem CID 176711076) has the molecular formula C14H14Cl2N4O2S and a molecular weight of 373.27 g/mol. Its IUPAC name is [4-[(6-chloro-1H-indol-3-yl)sulfinylamino]-1-propylpyrazol-5-yl] hypochlorite.
| Compound Name | [4-[(6-chloro-1H-indol-3-yl)sulfinylamino]-1-propylpyrazol-5-yl] hypochlorite |
|---|---|
| PubChem CID | 176711076 |
| Molecular Formula | C14H14Cl2N4O2S |
| Molecular Weight | 373.27 g/mol |
| Exact Mass | 372.02 |
| IUPAC Name | [4-[(6-chloro-1H-indol-3-yl)sulfinylamino]-1-propylpyrazol-5-yl] hypochlorite |
| SMILES | CCCn1ncc(NS(=O)c2c[nH]c3cc(Cl)ccc23)c1OCl |
| InChI | InChI=1S/C14H14Cl2N4O2S/c1-2-5-20-14(22-16)12(7-18-20)19-23(21)13-8-17-11-6-9(15)3-4-10(11)13/h3-4,6-8,17,19H,2,5H2,1H3 |
| InChIKey | LWXBNRZTSXDDLR-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 71.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.27 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |