C23H27N5O2 — CID 164909597
5-[4-(4-methoxyphenyl)piperazin-1-yl]-2-pyridin-2-yl-4,5,6,7-tetrahydro-1H-indazol-3-one (PubChem CID 164909597) has the molecular formula C23H27N5O2 and a molecular weight of 405.50 g/mol. Its IUPAC name is 5-[4-(4-methoxyphenyl)piperazin-1-yl]-2-pyridin-2-yl-4,5,6,7-tetrahydro-1H-indazol-3-one.
| Compound Name | 5-[4-(4-methoxyphenyl)piperazin-1-yl]-2-pyridin-2-yl-4,5,6,7-tetrahydro-1H-indazol-3-one |
|---|---|
| PubChem CID | 164909597 |
| Molecular Formula | C23H27N5O2 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.22 |
| IUPAC Name | 5-[4-(4-methoxyphenyl)piperazin-1-yl]-2-pyridin-2-yl-4,5,6,7-tetrahydro-1H-indazol-3-one |
| SMILES | COc1ccc(N2CCN(C3CCc4[nH]n(-c5ccccn5)c(=O)c4C3)CC2)cc1 |
| InChI | InChI=1S/C23H27N5O2/c1-30-19-8-5-17(6-9-19)26-12-14-27(15-13-26)18-7-10-21-20(16-18)23(29)28(25-21)22-4-2-3-11-24-22/h2-6,8-9,11,18,25H,7,10,12-16H2,1H3 |
| InChIKey | YXRWHTNWYFFLAL-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 66.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|