C27H44O — CID 164910427
(6R)-1,1-dideuterio-6-[(8R,9S,10S,13R,14S,17R)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-(trideuteriomethyl)hept-1-en-3-one (PubChem CID 164910427) has the molecular formula C27H44O and a molecular weight of 389.68 g/mol. Its IUPAC name is (6R)-1,1-dideuterio-6-[(8R,9S,10S,13R,14S,17R)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-(trideuteriomethyl)hept-1-en-3-one.
| Compound Name | (6R)-1,1-dideuterio-6-[(8R,9S,10S,13R,14S,17R)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-(trideuteriomethyl)hept-1-en-3-one |
|---|---|
| PubChem CID | 164910427 |
| Molecular Formula | C27H44O |
| Molecular Weight | 389.68 g/mol |
| Exact Mass | 389.37 |
| IUPAC Name | (6R)-1,1-dideuterio-6-[(8R,9S,10S,13R,14S,17R)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-(trideuteriomethyl)hept-1-en-3-one |
| SMILES | [2H]C([2H])=C(C(=O)CC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CCC4CCCC[C@]4(C)[C@H]3CC[C@]12C)C([2H])([2H])[2H] |
| InChI | InChI=1S/C27H44O/c1-18(2)25(28)14-9-19(3)22-12-13-23-21-11-10-20-8-6-7-16-26(20,4)24(21)15-17-27(22,23)5/h19-24H,1,6-17H2,2-5H3/t19-,20?,21+,22-,23+,24+,26+,27-/m1/s1/i1D2,2D3 |
| InChIKey | HFZQKVVLUXEGML-YCJMYGSSSA-N |
| XLogP | 7.60 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.68 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|