C42H24N6O2 — CID 164913505
6-[7-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzofuran-1-yl]quinoxalino[2,1-b]quinazolin-12-one (PubChem CID 164913505) has the molecular formula C42H24N6O2 and a molecular weight of 644.69 g/mol. Its IUPAC name is 6-[7-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzofuran-1-yl]quinoxalino[2,1-b]quinazolin-12-one.
| Compound Name | 6-[7-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzofuran-1-yl]quinoxalino[2,1-b]quinazolin-12-one |
|---|---|
| PubChem CID | 164913505 |
| Molecular Formula | C42H24N6O2 |
| Molecular Weight | 644.69 g/mol |
| Exact Mass | 644.20 |
| IUPAC Name | 6-[7-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzofuran-1-yl]quinoxalino[2,1-b]quinazolin-12-one |
| SMILES | O=c1c2ccccc2nc2c(-c3cccc4oc5cc(-c6nc(-c7ccccc7)nc(-c7ccccc7)n6)ccc5c34)nc3ccccc3n12 |
| InChI | InChI=1S/C42H24N6O2/c49-42-28-16-7-8-18-31(28)44-41-37(43-32-19-9-10-20-33(32)48(41)42)30-17-11-21-34-36(30)29-23-22-27(24-35(29)50-34)40-46-38(25-12-3-1-4-13-25)45-39(47-40)26-14-5-2-6-15-26/h1-24H |
| InChIKey | FNSTWHADFFHCNE-UHFFFAOYSA-N |
| XLogP | 9.15 |
| TPSA | 99.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.69 |
| LogP ≤ 5 | 9.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|