C14H19F3N2O4 — CID 164914275
2-[4-(2-methylpropoxy)-6-oxo-3-propan-2-yl-5-(trifluoromethyl)pyridazin-1-yl]acetic acid (PubChem CID 164914275) has the molecular formula C14H19F3N2O4 and a molecular weight of 336.31 g/mol. Its IUPAC name is 2-[4-(2-methylpropoxy)-6-oxo-3-propan-2-yl-5-(trifluoromethyl)pyridazin-1-yl]acetic acid.
| Compound Name | 2-[4-(2-methylpropoxy)-6-oxo-3-propan-2-yl-5-(trifluoromethyl)pyridazin-1-yl]acetic acid |
|---|---|
| PubChem CID | 164914275 |
| Molecular Formula | C14H19F3N2O4 |
| Molecular Weight | 336.31 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | 2-[4-(2-methylpropoxy)-6-oxo-3-propan-2-yl-5-(trifluoromethyl)pyridazin-1-yl]acetic acid |
| SMILES | CC(C)COc1c(C(C)C)nn(CC(=O)O)c(=O)c1C(F)(F)F |
| InChI | InChI=1S/C14H19F3N2O4/c1-7(2)6-23-12-10(14(15,16)17)13(22)19(5-9(20)21)18-11(12)8(3)4/h7-8H,5-6H2,1-4H3,(H,20,21) |
| InChIKey | GVXODZMPCCSZQH-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.31 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |