C15H21FN2O4 — CID 164914294
ethyl 2-[4-[(1-fluorocyclopropyl)methoxy]-6-oxo-3-propan-2-ylpyridazin-1-yl]acetate (PubChem CID 164914294) has the molecular formula C15H21FN2O4 and a molecular weight of 312.34 g/mol. Its IUPAC name is ethyl 2-[4-[(1-fluorocyclopropyl)methoxy]-6-oxo-3-propan-2-ylpyridazin-1-yl]acetate.
| Compound Name | ethyl 2-[4-[(1-fluorocyclopropyl)methoxy]-6-oxo-3-propan-2-ylpyridazin-1-yl]acetate |
|---|---|
| PubChem CID | 164914294 |
| Molecular Formula | C15H21FN2O4 |
| Molecular Weight | 312.34 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | ethyl 2-[4-[(1-fluorocyclopropyl)methoxy]-6-oxo-3-propan-2-ylpyridazin-1-yl]acetate |
| SMILES | CCOC(=O)Cn1nc(C(C)C)c(OCC2(F)CC2)cc1=O |
| InChI | InChI=1S/C15H21FN2O4/c1-4-21-13(20)8-18-12(19)7-11(14(17-18)10(2)3)22-9-15(16)5-6-15/h7,10H,4-6,8-9H2,1-3H3 |
| InChIKey | GFWVEGCKANEHKD-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.34 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |