C17H18F3N7O3 — CID 164914340
2-[6-oxo-3-propan-2-yl-4-(3,3,3-trifluoropropoxy)pyridazin-1-yl]-N-([1,2,4]triazolo[4,3-b]pyridazin-6-yl)acetamide (PubChem CID 164914340) has the molecular formula C17H18F3N7O3 and a molecular weight of 425.37 g/mol. Its IUPAC name is 2-[6-oxo-3-propan-2-yl-4-(3,3,3-trifluoropropoxy)pyridazin-1-yl]-N-([1,2,4]triazolo[4,3-b]pyridazin-6-yl)acetamide.
| Compound Name | 2-[6-oxo-3-propan-2-yl-4-(3,3,3-trifluoropropoxy)pyridazin-1-yl]-N-([1,2,4]triazolo[4,3-b]pyridazin-6-yl)acetamide |
|---|---|
| PubChem CID | 164914340 |
| Molecular Formula | C17H18F3N7O3 |
| Molecular Weight | 425.37 g/mol |
| Exact Mass | 425.14 |
| IUPAC Name | 2-[6-oxo-3-propan-2-yl-4-(3,3,3-trifluoropropoxy)pyridazin-1-yl]-N-([1,2,4]triazolo[4,3-b]pyridazin-6-yl)acetamide |
| SMILES | CC(C)c1nn(CC(=O)Nc2ccc3nncn3n2)c(=O)cc1OCCC(F)(F)F |
| InChI | InChI=1S/C17H18F3N7O3/c1-10(2)16-11(30-6-5-17(18,19)20)7-15(29)26(25-16)8-14(28)22-12-3-4-13-23-21-9-27(13)24-12/h3-4,7,9-10H,5-6,8H2,1-2H3,(H,22,24,28) |
| InChIKey | MXHNOXLCEIRHGL-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 116.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.37 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |