C26H27ClN4O3 — CID 164915306
5-[2-[4-[(3-chlorophenyl)methylamino]butoxy]ethoxy]benzo[c][2,6]naphthyridine-8-carboxamide (PubChem CID 164915306) has the molecular formula C26H27ClN4O3 and a molecular weight of 478.98 g/mol. Its IUPAC name is 5-[2-[4-[(3-chlorophenyl)methylamino]butoxy]ethoxy]benzo[c][2,6]naphthyridine-8-carboxamide.
| Compound Name | 5-[2-[4-[(3-chlorophenyl)methylamino]butoxy]ethoxy]benzo[c][2,6]naphthyridine-8-carboxamide |
|---|---|
| PubChem CID | 164915306 |
| Molecular Formula | C26H27ClN4O3 |
| Molecular Weight | 478.98 g/mol |
| Exact Mass | 478.18 |
| IUPAC Name | 5-[2-[4-[(3-chlorophenyl)methylamino]butoxy]ethoxy]benzo[c][2,6]naphthyridine-8-carboxamide |
| SMILES | NC(=O)c1ccc2c(c1)nc(OCCOCCCCNCc1cccc(Cl)c1)c1ccncc12 |
| InChI | InChI=1S/C26H27ClN4O3/c27-20-5-3-4-18(14-20)16-29-9-1-2-11-33-12-13-34-26-22-8-10-30-17-23(22)21-7-6-19(25(28)32)15-24(21)31-26/h3-8,10,14-15,17,29H,1-2,9,11-13,16H2,(H2,28,32) |
| InChIKey | DTBNAWPAMVKNGW-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 99.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.98 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|