C22H20ClF4N5O2S — CID 164918404
7-chloro-6-(1,1-dioxo-1,4-thiazinan-4-yl)-N-[(1R)-1-[2-fluoro-3-(trifluoromethyl)phenyl]prop-2-enyl]-2-methylpyrido[2,3-d]pyrimidin-4-amine (PubChem CID 164918404) has the molecular formula C22H20ClF4N5O2S and a molecular weight of 529.95 g/mol. Its IUPAC name is 7-chloro-6-(1,1-dioxo-1,4-thiazinan-4-yl)-N-[(1R)-1-[2-fluoro-3-(trifluoromethyl)phenyl]prop-2-enyl]-2-methylpyrido[2,3-d]pyrimidin-4-amine.
| Compound Name | 7-chloro-6-(1,1-dioxo-1,4-thiazinan-4-yl)-N-[(1R)-1-[2-fluoro-3-(trifluoromethyl)phenyl]prop-2-enyl]-2-methylpyrido[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 164918404 |
| Molecular Formula | C22H20ClF4N5O2S |
| Molecular Weight | 529.95 g/mol |
| Exact Mass | 529.10 |
| IUPAC Name | 7-chloro-6-(1,1-dioxo-1,4-thiazinan-4-yl)-N-[(1R)-1-[2-fluoro-3-(trifluoromethyl)phenyl]prop-2-enyl]-2-methylpyrido[2,3-d]pyrimidin-4-amine |
| SMILES | C=C[C@@H](Nc1nc(C)nc2nc(Cl)c(N3CCS(=O)(=O)CC3)cc12)c1cccc(C(F)(F)F)c1F |
| InChI | InChI=1S/C22H20ClF4N5O2S/c1-3-16(13-5-4-6-15(18(13)24)22(25,26)27)30-20-14-11-17(32-7-9-35(33,34)10-8-32)19(23)31-21(14)29-12(2)28-20/h3-6,11,16H,1,7-10H2,2H3,(H,28,29,30,31)/t16-/m1/s1 |
| InChIKey | WRDJUBWIIIVEDP-MRXNPFEDSA-N |
| XLogP | 4.72 |
| TPSA | 88.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.95 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|