C22H25ClFN7O2 — CID 164920302
2-[3-chloro-6-[2-[3-(methylamino)cyclobutyl]iminopropanehydrazonoyl]pyrazolo[1,5-a]pyridin-4-yl]oxy-2-(5-fluoro-2-pyridinyl)ethanol (PubChem CID 164920302) has the molecular formula C22H25ClFN7O2 and a molecular weight of 473.94 g/mol. Its IUPAC name is 2-[3-chloro-6-[2-[3-(methylamino)cyclobutyl]iminopropanehydrazonoyl]pyrazolo[1,5-a]pyridin-4-yl]oxy-2-(5-fluoro-2-pyridinyl)ethanol.
| Compound Name | 2-[3-chloro-6-[2-[3-(methylamino)cyclobutyl]iminopropanehydrazonoyl]pyrazolo[1,5-a]pyridin-4-yl]oxy-2-(5-fluoro-2-pyridinyl)ethanol |
|---|---|
| PubChem CID | 164920302 |
| Molecular Formula | C22H25ClFN7O2 |
| Molecular Weight | 473.94 g/mol |
| Exact Mass | 473.17 |
| IUPAC Name | 2-[3-chloro-6-[2-[3-(methylamino)cyclobutyl]iminopropanehydrazonoyl]pyrazolo[1,5-a]pyridin-4-yl]oxy-2-(5-fluoro-2-pyridinyl)ethanol |
| SMILES | CNC1CC(/N=C(C)/C(=N\N)c2cc(OC(CO)c3ccc(F)cn3)c3c(Cl)cnn3c2)C1 |
| InChI | InChI=1S/C22H25ClFN7O2/c1-12(29-16-6-15(7-16)26-2)21(30-25)13-5-19(22-17(23)9-28-31(22)10-13)33-20(11-32)18-4-3-14(24)8-27-18/h3-5,8-10,15-16,20,26,32H,6-7,11,25H2,1-2H3/b29-12+,30-21+ |
| InChIKey | TXQADNIULSSDIM-JKEXQVSXSA-N |
| XLogP | 2.51 |
| TPSA | 122.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.94 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|