C24H23N9O — CID 164921413
6-[1-(1-cyanopiperidin-4-yl)-5-methyltriazol-4-yl]-4-[(1R)-1-pyridin-2-ylethoxy]pyrazolo[1,5-a]pyridine-3-carbonitrile (PubChem CID 164921413) has the molecular formula C24H23N9O and a molecular weight of 453.51 g/mol. Its IUPAC name is 6-[1-(1-cyanopiperidin-4-yl)-5-methyltriazol-4-yl]-4-[(1R)-1-pyridin-2-ylethoxy]pyrazolo[1,5-a]pyridine-3-carbonitrile.
| Compound Name | 6-[1-(1-cyanopiperidin-4-yl)-5-methyltriazol-4-yl]-4-[(1R)-1-pyridin-2-ylethoxy]pyrazolo[1,5-a]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 164921413 |
| Molecular Formula | C24H23N9O |
| Molecular Weight | 453.51 g/mol |
| Exact Mass | 453.20 |
| IUPAC Name | 6-[1-(1-cyanopiperidin-4-yl)-5-methyltriazol-4-yl]-4-[(1R)-1-pyridin-2-ylethoxy]pyrazolo[1,5-a]pyridine-3-carbonitrile |
| SMILES | Cc1c(-c2cc(O[C@H](C)c3ccccn3)c3c(C#N)cnn3c2)nnn1C1CCN(C#N)CC1 |
| InChI | InChI=1S/C24H23N9O/c1-16-23(29-30-33(16)20-6-9-31(15-26)10-7-20)18-11-22(24-19(12-25)13-28-32(24)14-18)34-17(2)21-5-3-4-8-27-21/h3-5,8,11,13-14,17,20H,6-7,9-10H2,1-2H3/t17-/m1/s1 |
| InChIKey | UDGIMFIKYCJMBS-QGZVFWFLSA-N |
| XLogP | 3.43 |
| TPSA | 120.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.51 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|