C24H25N9O — CID 164921297
6-[2-(1-cyanopiperidin-4-yl)iminopropanehydrazonoyl]-4-(1-pyridin-2-ylethoxy)pyrazolo[1,5-a]pyridine-3-carbonitrile (PubChem CID 164921297) has the molecular formula C24H25N9O and a molecular weight of 455.53 g/mol. Its IUPAC name is 6-[2-(1-cyanopiperidin-4-yl)iminopropanehydrazonoyl]-4-(1-pyridin-2-ylethoxy)pyrazolo[1,5-a]pyridine-3-carbonitrile.
| Compound Name | 6-[2-(1-cyanopiperidin-4-yl)iminopropanehydrazonoyl]-4-(1-pyridin-2-ylethoxy)pyrazolo[1,5-a]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 164921297 |
| Molecular Formula | C24H25N9O |
| Molecular Weight | 455.53 g/mol |
| Exact Mass | 455.22 |
| IUPAC Name | 6-[2-(1-cyanopiperidin-4-yl)iminopropanehydrazonoyl]-4-(1-pyridin-2-ylethoxy)pyrazolo[1,5-a]pyridine-3-carbonitrile |
| SMILES | CC(=N\C1CCN(C#N)CC1)/C(=N\N)c1cc(OC(C)c2ccccn2)c2c(C#N)cnn2c1 |
| InChI | InChI=1S/C24H25N9O/c1-16(30-20-6-9-32(15-26)10-7-20)23(31-27)18-11-22(24-19(12-25)13-29-33(24)14-18)34-17(2)21-5-3-4-8-28-21/h3-5,8,11,13-14,17,20H,6-7,9-10,27H2,1-2H3/b30-16+,31-23+ |
| InChIKey | ZLAMCUOPGKCHID-KYBGMSMQSA-N |
| XLogP | 2.81 |
| TPSA | 140.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.53 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|