C24H29N11O — CID 164920905
6-[2-(1-cyanopiperidin-4-yl)iminopropanehydrazonoyl]-4-[1-(1-propan-2-yltriazol-4-yl)ethoxy]pyrazolo[1,5-a]pyridine-3-carbonitrile (PubChem CID 164920905) has the molecular formula C24H29N11O and a molecular weight of 487.57 g/mol. Its IUPAC name is 6-[2-(1-cyanopiperidin-4-yl)iminopropanehydrazonoyl]-4-[1-(1-propan-2-yltriazol-4-yl)ethoxy]pyrazolo[1,5-a]pyridine-3-carbonitrile.
| Compound Name | 6-[2-(1-cyanopiperidin-4-yl)iminopropanehydrazonoyl]-4-[1-(1-propan-2-yltriazol-4-yl)ethoxy]pyrazolo[1,5-a]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 164920905 |
| Molecular Formula | C24H29N11O |
| Molecular Weight | 487.57 g/mol |
| Exact Mass | 487.26 |
| IUPAC Name | 6-[2-(1-cyanopiperidin-4-yl)iminopropanehydrazonoyl]-4-[1-(1-propan-2-yltriazol-4-yl)ethoxy]pyrazolo[1,5-a]pyridine-3-carbonitrile |
| SMILES | CC(=N\C1CCN(C#N)CC1)/C(=N\N)c1cc(OC(C)c2cn(C(C)C)nn2)c2c(C#N)cnn2c1 |
| InChI | InChI=1S/C24H29N11O/c1-15(2)34-13-21(31-32-34)17(4)36-22-9-18(12-35-24(22)19(10-25)11-28-35)23(30-27)16(3)29-20-5-7-33(14-26)8-6-20/h9,11-13,15,17,20H,5-8,27H2,1-4H3/b29-16+,30-23+ |
| InChIKey | WKGIDBVJIOACFR-HZGAKYEPSA-N |
| XLogP | 2.59 |
| TPSA | 158.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.57 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|