C23H24F2N8O2 — CID 164921341
4-[[(1Z)-1-[3-fluoro-4-[2-(5-fluoro-2-pyridinyl)-2-hydroxyethoxy]pyrazolo[1,5-a]pyridin-6-yl]-1-hydrazinylidenepropan-2-ylidene]amino]piperidine-1-carbonitrile (PubChem CID 164921341) has the molecular formula C23H24F2N8O2 and a molecular weight of 482.50 g/mol. Its IUPAC name is 4-[[(1Z)-1-[3-fluoro-4-[2-(5-fluoro-2-pyridinyl)-2-hydroxyethoxy]pyrazolo[1,5-a]pyridin-6-yl]-1-hydrazinylidenepropan-2-ylidene]amino]piperidine-1-carbonitrile.
| Compound Name | 4-[[(1Z)-1-[3-fluoro-4-[2-(5-fluoro-2-pyridinyl)-2-hydroxyethoxy]pyrazolo[1,5-a]pyridin-6-yl]-1-hydrazinylidenepropan-2-ylidene]amino]piperidine-1-carbonitrile |
|---|---|
| PubChem CID | 164921341 |
| Molecular Formula | C23H24F2N8O2 |
| Molecular Weight | 482.50 g/mol |
| Exact Mass | 482.20 |
| IUPAC Name | 4-[[(1Z)-1-[3-fluoro-4-[2-(5-fluoro-2-pyridinyl)-2-hydroxyethoxy]pyrazolo[1,5-a]pyridin-6-yl]-1-hydrazinylidenepropan-2-ylidene]amino]piperidine-1-carbonitrile |
| SMILES | CC(=N\C1CCN(C#N)CC1)/C(=N\N)c1cc(OCC(O)c2ccc(F)cn2)c2c(F)cnn2c1 |
| InChI | InChI=1S/C23H24F2N8O2/c1-14(30-17-4-6-32(13-26)7-5-17)22(31-27)15-8-21(23-18(25)10-29-33(23)11-15)35-12-20(34)19-3-2-16(24)9-28-19/h2-3,8-11,17,20,34H,4-7,12,27H2,1H3/b30-14+,31-22+ |
| InChIKey | SCYNTPFIQBSFQQ-WPOJWVQTSA-N |
| XLogP | 2.19 |
| TPSA | 137.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.50 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|