C25H26FN9O2 — CID 164921348
6-[2-(1-cyanopiperidin-4-yl)iminopropanehydrazonoyl]-4-[1-(5-fluoro-2-pyridinyl)-2-methoxyethoxy]pyrazolo[1,5-a]pyridine-3-carbonitrile (PubChem CID 164921348) has the molecular formula C25H26FN9O2 and a molecular weight of 503.54 g/mol. Its IUPAC name is 6-[2-(1-cyanopiperidin-4-yl)iminopropanehydrazonoyl]-4-[1-(5-fluoro-2-pyridinyl)-2-methoxyethoxy]pyrazolo[1,5-a]pyridine-3-carbonitrile.
| Compound Name | 6-[2-(1-cyanopiperidin-4-yl)iminopropanehydrazonoyl]-4-[1-(5-fluoro-2-pyridinyl)-2-methoxyethoxy]pyrazolo[1,5-a]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 164921348 |
| Molecular Formula | C25H26FN9O2 |
| Molecular Weight | 503.54 g/mol |
| Exact Mass | 503.22 |
| IUPAC Name | 6-[2-(1-cyanopiperidin-4-yl)iminopropanehydrazonoyl]-4-[1-(5-fluoro-2-pyridinyl)-2-methoxyethoxy]pyrazolo[1,5-a]pyridine-3-carbonitrile |
| SMILES | COCC(Oc1cc(C(=N/N)/C(C)=N/C2CCN(C#N)CC2)cn2ncc(C#N)c12)c1ccc(F)cn1 |
| InChI | InChI=1S/C25H26FN9O2/c1-16(32-20-5-7-34(15-28)8-6-20)24(33-29)17-9-22(25-18(10-27)11-31-35(25)13-17)37-23(14-36-2)21-4-3-19(26)12-30-21/h3-4,9,11-13,20,23H,5-8,14,29H2,1-2H3/b32-16+,33-24+ |
| InChIKey | BIMGRLQHCNQZCY-HFUDCZDOSA-N |
| XLogP | 2.58 |
| TPSA | 150.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.54 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|