C17H18N8O — CID 164920665
6-[2-(1-cyanopiperidin-4-yl)iminopropanehydrazonoyl]-4-hydroxypyrazolo[1,5-a]pyridine-3-carbonitrile (PubChem CID 164920665) has the molecular formula C17H18N8O and a molecular weight of 350.39 g/mol. Its IUPAC name is 6-[2-(1-cyanopiperidin-4-yl)iminopropanehydrazonoyl]-4-hydroxypyrazolo[1,5-a]pyridine-3-carbonitrile.
| Compound Name | 6-[2-(1-cyanopiperidin-4-yl)iminopropanehydrazonoyl]-4-hydroxypyrazolo[1,5-a]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 164920665 |
| Molecular Formula | C17H18N8O |
| Molecular Weight | 350.39 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | 6-[2-(1-cyanopiperidin-4-yl)iminopropanehydrazonoyl]-4-hydroxypyrazolo[1,5-a]pyridine-3-carbonitrile |
| SMILES | CC(=N\C1CCN(C#N)CC1)/C(=N\N)c1cc(O)c2c(C#N)cnn2c1 |
| InChI | InChI=1S/C17H18N8O/c1-11(22-14-2-4-24(10-19)5-3-14)16(23-20)12-6-15(26)17-13(7-18)8-21-25(17)9-12/h6,8-9,14,26H,2-5,20H2,1H3/b22-11+,23-16+ |
| InChIKey | VNZWKADILOGMPV-KEVKURSMSA-N |
| XLogP | 0.98 |
| TPSA | 139.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.39 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|