C18H19N7O — CID 164921432
6-[(Z)-1-amino-3-(1-cyanopiperidin-4-yl)iminoprop-1-en-2-yl]-4-methoxypyrazolo[1,5-a]pyridine-3-carbonitrile (PubChem CID 164921432) has the molecular formula C18H19N7O and a molecular weight of 349.40 g/mol. Its IUPAC name is 6-[(Z)-1-amino-3-(1-cyanopiperidin-4-yl)iminoprop-1-en-2-yl]-4-methoxypyrazolo[1,5-a]pyridine-3-carbonitrile.
| Compound Name | 6-[(Z)-1-amino-3-(1-cyanopiperidin-4-yl)iminoprop-1-en-2-yl]-4-methoxypyrazolo[1,5-a]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 164921432 |
| Molecular Formula | C18H19N7O |
| Molecular Weight | 349.40 g/mol |
| Exact Mass | 349.17 |
| IUPAC Name | 6-[(Z)-1-amino-3-(1-cyanopiperidin-4-yl)iminoprop-1-en-2-yl]-4-methoxypyrazolo[1,5-a]pyridine-3-carbonitrile |
| SMILES | COc1cc(C(=C/N)/C=N/C2CCN(C#N)CC2)cn2ncc(C#N)c12 |
| InChI | InChI=1S/C18H19N7O/c1-26-17-6-13(11-25-18(17)15(8-20)10-23-25)14(7-19)9-22-16-2-4-24(12-21)5-3-16/h6-7,9-11,16H,2-5,19H2,1H3/b14-7+,22-9+ |
| InChIKey | DMCKTMASSJUQOZ-WYUFJTEYSA-N |
| XLogP | 1.53 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.40 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|