C28H32ClN7O — CID 164920613
4-[[(Z)-4-amino-3-[3-chloro-4-[1-(2-cyanophenyl)ethoxy]pyrazolo[1,5-a]pyridin-6-yl]but-3-en-2-ylidene]amino]piperidine-1-carbonitrile;ethane (PubChem CID 164920613) has the molecular formula C28H32ClN7O and a molecular weight of 518.07 g/mol. Its IUPAC name is 4-[[(Z)-4-amino-3-[3-chloro-4-[1-(2-cyanophenyl)ethoxy]pyrazolo[1,5-a]pyridin-6-yl]but-3-en-2-ylidene]amino]piperidine-1-carbonitrile;ethane.
| Compound Name | 4-[[(Z)-4-amino-3-[3-chloro-4-[1-(2-cyanophenyl)ethoxy]pyrazolo[1,5-a]pyridin-6-yl]but-3-en-2-ylidene]amino]piperidine-1-carbonitrile;ethane |
|---|---|
| PubChem CID | 164920613 |
| Molecular Formula | C28H32ClN7O |
| Molecular Weight | 518.07 g/mol |
| Exact Mass | 517.24 |
| IUPAC Name | 4-[[(Z)-4-amino-3-[3-chloro-4-[1-(2-cyanophenyl)ethoxy]pyrazolo[1,5-a]pyridin-6-yl]but-3-en-2-ylidene]amino]piperidine-1-carbonitrile;ethane |
| SMILES | CC.CC(=N\C1CCN(C#N)CC1)/C(=C\N)c1cc(OC(C)c2ccccc2C#N)c2c(Cl)cnn2c1 |
| InChI | InChI=1S/C26H26ClN7O.C2H6/c1-17(32-21-7-9-33(16-30)10-8-21)23(13-29)20-11-25(26-24(27)14-31-34(26)15-20)35-18(2)22-6-4-3-5-19(22)12-28;1-2/h3-6,11,13-15,18,21H,7-10,29H2,1-2H3;1-2H3/b23-13+,32-17+; |
| InChIKey | QIURHSJSNBHPLO-ZGAFDREUSA-N |
| XLogP | 5.73 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.07 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|