C23H25ClN8O2 — CID 164921160
4-[[(1Z)-1-[3-chloro-4-(2-hydroxy-1-pyridin-2-ylethoxy)pyrazolo[1,5-a]pyridin-6-yl]-1-hydrazinylidenepropan-2-ylidene]amino]piperidine-1-carbonitrile (PubChem CID 164921160) has the molecular formula C23H25ClN8O2 and a molecular weight of 480.96 g/mol. Its IUPAC name is 4-[[(1Z)-1-[3-chloro-4-(2-hydroxy-1-pyridin-2-ylethoxy)pyrazolo[1,5-a]pyridin-6-yl]-1-hydrazinylidenepropan-2-ylidene]amino]piperidine-1-carbonitrile.
| Compound Name | 4-[[(1Z)-1-[3-chloro-4-(2-hydroxy-1-pyridin-2-ylethoxy)pyrazolo[1,5-a]pyridin-6-yl]-1-hydrazinylidenepropan-2-ylidene]amino]piperidine-1-carbonitrile |
|---|---|
| PubChem CID | 164921160 |
| Molecular Formula | C23H25ClN8O2 |
| Molecular Weight | 480.96 g/mol |
| Exact Mass | 480.18 |
| IUPAC Name | 4-[[(1Z)-1-[3-chloro-4-(2-hydroxy-1-pyridin-2-ylethoxy)pyrazolo[1,5-a]pyridin-6-yl]-1-hydrazinylidenepropan-2-ylidene]amino]piperidine-1-carbonitrile |
| SMILES | CC(=N\C1CCN(C#N)CC1)/C(=N\N)c1cc(OC(CO)c2ccccn2)c2c(Cl)cnn2c1 |
| InChI | InChI=1S/C23H25ClN8O2/c1-15(29-17-5-8-31(14-25)9-6-17)22(30-26)16-10-20(23-18(24)11-28-32(23)12-16)34-21(13-33)19-4-2-3-7-27-19/h2-4,7,10-12,17,21,33H,5-6,8-9,13,26H2,1H3/b29-15+,30-22+ |
| InChIKey | BFVAPERMXCQSQK-IBIVALJOSA-N |
| XLogP | 2.56 |
| TPSA | 137.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.96 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|