C22H22ClFN8O — CID 171074970
4-[[(1Z)-1-[3-chloro-4-[(5-fluoro-2-pyridinyl)methoxy]pyrazolo[1,5-a]pyridin-6-yl]-1-hydrazinylidenepropan-2-ylidene]amino]piperidine-1-carbonitrile (PubChem CID 171074970) has the molecular formula C22H22ClFN8O and a molecular weight of 468.92 g/mol. Its IUPAC name is 4-[[(1Z)-1-[3-chloro-4-[(5-fluoro-2-pyridinyl)methoxy]pyrazolo[1,5-a]pyridin-6-yl]-1-hydrazinylidenepropan-2-ylidene]amino]piperidine-1-carbonitrile.
| Compound Name | 4-[[(1Z)-1-[3-chloro-4-[(5-fluoro-2-pyridinyl)methoxy]pyrazolo[1,5-a]pyridin-6-yl]-1-hydrazinylidenepropan-2-ylidene]amino]piperidine-1-carbonitrile |
|---|---|
| PubChem CID | 171074970 |
| Molecular Formula | C22H22ClFN8O |
| Molecular Weight | 468.92 g/mol |
| Exact Mass | 468.16 |
| IUPAC Name | 4-[[(1Z)-1-[3-chloro-4-[(5-fluoro-2-pyridinyl)methoxy]pyrazolo[1,5-a]pyridin-6-yl]-1-hydrazinylidenepropan-2-ylidene]amino]piperidine-1-carbonitrile |
| SMILES | CC(=N\C1CCN(C#N)CC1)/C(=N\N)c1cc(OCc2ccc(F)cn2)c2c(Cl)cnn2c1 |
| InChI | InChI=1S/C22H22ClFN8O/c1-14(29-17-4-6-31(13-25)7-5-17)21(30-26)15-8-20(22-19(23)10-28-32(22)11-15)33-12-18-3-2-16(24)9-27-18/h2-3,8-11,17H,4-7,12,26H2,1H3/b29-14+,30-21+ |
| InChIKey | IKVMZUKNIQOZDH-GVODOLINSA-N |
| XLogP | 3.17 |
| TPSA | 117.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.92 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|