C26H28F2N8O3 — CID 169267503
4-[2-(3,5-difluoro-2-pyridinyl)-2-hydroxyethoxy]-6-[2-[1-(oxetan-3-yl)piperidin-4-yl]iminopropanehydrazonoyl]pyrazolo[1,5-a]pyridine-3-carbonitrile (PubChem CID 169267503) has the molecular formula C26H28F2N8O3 and a molecular weight of 538.56 g/mol. Its IUPAC name is 4-[2-(3,5-difluoro-2-pyridinyl)-2-hydroxyethoxy]-6-[2-[1-(oxetan-3-yl)piperidin-4-yl]iminopropanehydrazonoyl]pyrazolo[1,5-a]pyridine-3-carbonitrile.
| Compound Name | 4-[2-(3,5-difluoro-2-pyridinyl)-2-hydroxyethoxy]-6-[2-[1-(oxetan-3-yl)piperidin-4-yl]iminopropanehydrazonoyl]pyrazolo[1,5-a]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 169267503 |
| Molecular Formula | C26H28F2N8O3 |
| Molecular Weight | 538.56 g/mol |
| Exact Mass | 538.23 |
| IUPAC Name | 4-[2-(3,5-difluoro-2-pyridinyl)-2-hydroxyethoxy]-6-[2-[1-(oxetan-3-yl)piperidin-4-yl]iminopropanehydrazonoyl]pyrazolo[1,5-a]pyridine-3-carbonitrile |
| SMILES | CC(=N\C1CCN(C2COC2)CC1)/C(=N\N)c1cc(OCC(O)c2ncc(F)cc2F)c2c(C#N)cnn2c1 |
| InChI | InChI=1S/C26H28F2N8O3/c1-15(33-19-2-4-35(5-3-19)20-12-38-13-20)24(34-30)16-6-23(26-17(8-29)9-32-36(26)11-16)39-14-22(37)25-21(28)7-18(27)10-31-25/h6-7,9-11,19-20,22,37H,2-5,12-14,30H2,1H3/b33-15+,34-24+ |
| InChIKey | OFIJJNBDOFUDDZ-NOVFNVOSSA-N |
| XLogP | 1.98 |
| TPSA | 146.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.56 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|