C24H25F3N8O — CID 164921064
6-(2-piperidin-4-yliminopropanehydrazonoyl)-4-[1-[5-(trifluoromethyl)-3-pyridinyl]ethoxy]pyrazolo[1,5-a]pyridine-3-carbonitrile (PubChem CID 164921064) has the molecular formula C24H25F3N8O and a molecular weight of 498.51 g/mol. Its IUPAC name is 6-(2-piperidin-4-yliminopropanehydrazonoyl)-4-[1-[5-(trifluoromethyl)-3-pyridinyl]ethoxy]pyrazolo[1,5-a]pyridine-3-carbonitrile.
| Compound Name | 6-(2-piperidin-4-yliminopropanehydrazonoyl)-4-[1-[5-(trifluoromethyl)-3-pyridinyl]ethoxy]pyrazolo[1,5-a]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 164921064 |
| Molecular Formula | C24H25F3N8O |
| Molecular Weight | 498.51 g/mol |
| Exact Mass | 498.21 |
| IUPAC Name | 6-(2-piperidin-4-yliminopropanehydrazonoyl)-4-[1-[5-(trifluoromethyl)-3-pyridinyl]ethoxy]pyrazolo[1,5-a]pyridine-3-carbonitrile |
| SMILES | CC(=N\C1CCNCC1)/C(=N\N)c1cc(OC(C)c2cncc(C(F)(F)F)c2)c2c(C#N)cnn2c1 |
| InChI | InChI=1S/C24H25F3N8O/c1-14(33-20-3-5-30-6-4-20)22(34-29)17-8-21(23-18(9-28)11-32-35(23)13-17)36-15(2)16-7-19(12-31-10-16)24(25,26)27/h7-8,10-13,15,20,30H,3-6,29H2,1-2H3/b33-14+,34-22+ |
| InChIKey | MDXIZDRCTOBMNE-NGXHUPGDSA-N |
| XLogP | 3.64 |
| TPSA | 125.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.51 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|