C20H24N2S — CID 164922828
2-methyl-10-[[(3S)-1-methylpiperidin-3-yl]methyl]phenothiazine (PubChem CID 164922828) has the molecular formula C20H24N2S and a molecular weight of 324.49 g/mol. Its IUPAC name is 2-methyl-10-[[(3S)-1-methylpiperidin-3-yl]methyl]phenothiazine.
| Compound Name | 2-methyl-10-[[(3S)-1-methylpiperidin-3-yl]methyl]phenothiazine |
|---|---|
| PubChem CID | 164922828 |
| Molecular Formula | C20H24N2S |
| Molecular Weight | 324.49 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | 2-methyl-10-[[(3S)-1-methylpiperidin-3-yl]methyl]phenothiazine |
| SMILES | Cc1ccc2c(c1)N(C[C@H]1CCCN(C)C1)c1ccccc1S2 |
| InChI | InChI=1S/C20H24N2S/c1-15-9-10-20-18(12-15)22(14-16-6-5-11-21(2)13-16)17-7-3-4-8-19(17)23-20/h3-4,7-10,12,16H,5-6,11,13-14H2,1-2H3/t16-/m0/s1 |
| InChIKey | HEOVMZXVAKVEFS-INIZCTEOSA-N |
| XLogP | 4.94 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.49 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |